Methyl 4-iodo-3-nitrobenzoate is a research compound studied for its potential local anesthetic properties. It is structurally related to dimethocaine and is primarily used in laboratory investigations of anesthetic activity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 89976-27-2
3,4-dimethoxyphenylmagnesium bromide
Grignard reagent for organic synthesis
(R)-4-hydroxy-N,N-diphenylpent-2-ynamide
research compound
(E)-3-(5-Nitrocyclohex-1-en-1-yl)acrylic acid
Research compound
Magnesium chloride 3,5-dimethoxybenzen-1-ide (1/1/1)
Grignard reagent for organic synthesis
methyl 4-iodo-3-nitrobenzoate
SCMBIQRYVKITCY-UHFFFAOYSA-N
COC(=O)C1=CC(=C(C=C1)I)[N+](=O)[O-]