4-Bromo-3-nitro-1H-pyrazole is a research compound used primarily in laboratory and manufacturing settings. It features a single aromatic ring with a bromine atom, a nitro group, and a heterocyclic structure, contributing to its moderate polarity and low molecular weight.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 89717-64-6
2-Isopropylbenzeneboronic acid
research compound
5-(Ethylthio)-1H-tetrazole
Oligonucleotide synthesis activator
1-(chloromethyl)-3-(trifluoromethoxy)benzene
research compound
6-Bromo-1H-indole-4-carboxylic acid
Research reagent for chemical synthesis
4-bromo-5-nitro-1H-pyrazole
WEQNDTYVEHMMMX-UHFFFAOYSA-N
C1=NNC(=C1Br)[N+](=O)[O-]