BippyPhos is a bipyrazole ligand used in research as a reagent for coordination chemistry and catalysis. Its structure features a phosphine group attached to a bipyrazole core with multiple aromatic rings, contributing to its role in organometallic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 894086-00-1
(2-hydroxyphenyl)boronic Acid
chemical building block for boronic acid reactions
6-bromo-2-methoxypyridin-3-amine
research reagent
2-Bromo-4-methoxypyridine
Research reagent
1-cyclohexenylboronic Acid
research compound
ditert-butyl-[2-(1,3,5-triphenylpyrazol-4-yl)pyrazol-3-yl]phosphane
PTXJGGGNGMPMBG-UHFFFAOYSA-N
CC(C)(C)P(C1=CC=NN1C2=C(N(N=C2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C(C)(C)C