This compound is a polymeric-type industrial chemical with a large, flexible molecular structure. Its complex architecture features multiple aromatic rings, amine groups, and ester linkages, which contribute to its high molecular weight and hydrophobic character.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 886463-10-1
1,1-bis(acryloyloxymethyl)ethyl isocyanate
crosslinking agent monomer
Dimethyl 2,5-Dioxahexanedioate
intermediate for polyester synthesis
PPG-2 methyl ether acetate
solvent in coatings and inks
3,3,3-trifluoro-2,2-dimethylpropanoic acid
chemical intermediate for synthesis
2-[3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanoyloxy]ethyl 3-[4-[4-[2-benzyl-2-(dimethylamino)butanoyl]phenyl]piperazin-1-yl]propanoate
XYNGFZCNHCODJJ-UHFFFAOYSA-N
CCC(CC1=CC=CC=C1)(C(=O)C2=CC=C(C=C2)N3CCN(CC3)CCC(=O)OCCOC(=O)CCN4CCN(CC4)C5=CC=C(C=C5)C(=O)C(CC)(CC6=CC=CC=C6)N(C)C)N(C)C