This compound is an indole-containing acetic acid derivative used primarily as a research reagent. It features a biphenyl structure linked to an indole ring, giving it a relatively high molecular weight and moderate lipophilicity.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 886363-20-8
2-(4-(1h-indol-5-yl)phenyl)acetic acid
pharmaceutical intermediate
5-Bromo-4-methylpyridine-2-carbonitrile
research reagent
5-Bromo-4-methylpyridine-2-carboxylic acid
research compound
2-BROMO-4-(PYRIDIN-2-YL)THIAZOLE
Research compound
3-Bromo-6-chloroimidazo[1,2-a]pyridine
Research compound
3-(1H-indol-5-yl)benzoic Acid
Research compound
2-(2-(1h-indol-5-yl)phenyl)acetic acid
research compound
4-(1H-indol-5-yl)benzoic Acid
research compound
2-[3-(1H-indol-5-yl)phenyl]acetic acid
UTQLDLXUWNVRHF-UHFFFAOYSA-N
C1=CC(=CC(=C1)C2=CC3=C(C=C2)NC=C3)CC(=O)O
—