2-(1H-indol-5-yl)benzoic acid is an indole-containing aromatic carboxylic acid used as a research compound. It features both a benzoic acid moiety and an indole ring system, contributing to its structural properties for laboratory investigations.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 886363-17-3
5-Bromo-4-methylpyridine-2-carbonitrile
research reagent
5-Bromo-4-methylpyridine-2-carboxylic acid
research compound
2-(2-(1h-indol-5-yl)phenyl)acetic acid
research compound
3-(1H-indol-5-yl)benzoic Acid
Research compound
4-(1H-indol-5-yl)benzoic Acid
research compound
2-(4-(1h-indol-5-yl)phenyl)acetic acid
pharmaceutical intermediate
2-(1H-indol-5-yl)benzoic acid
PKGXRKSYWVXMKT-UHFFFAOYSA-N
C1=CC=C(C(=C1)C2=CC3=C(C=C2)NC=C3)C(=O)O