This compound is a pharmaceutical intermediate featuring a piperidine ring, a carboxylic acid group, and protective groups. It is typically used in the synthesis of more complex pharmaceutical agents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 886362-33-0
3-N-Fmoc-amino-3-(3'-Cbz)piperidine-propionic acid
Pharmaceutical intermediate for peptide synthesis
Tert-butyl 4-(3-bromophenyl)piperidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
4,5-difluoro-2-methylindole-3-carboxylic acid ethyl ester
Pharmaceutical intermediate
Ethyl 5-fluoro-2-methyl-1h-indole-3-carboxylate
pharmaceutical intermediate
3-[(2-methylpropan-2-yl)oxycarbonylamino]-3-(1-phenylmethoxycarbonylpiperidin-4-yl)propanoic acid
UBHLDUJTRRPSSS-UHFFFAOYSA-N
CC(C)(C)OC(=O)NC(CC(=O)O)C1CCN(CC1)C(=O)OCC2=CC=CC=C2
—