6-Bromo-1H-indazole-4-carboxylic acid is a brominated indazole derivative used primarily as a research compound. It features a carboxylic acid functional group and an aromatic heterocyclic ring system, making it valuable for laboratory and synthetic chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 885523-08-0
4,4,5,5-tetramethyl-2-(3-methylthiophen-2-yl)-1,3,2-dioxaborolane
boronic ester for organic synthesis
1-acetyl-4-bromo-1H-indazole
research compound
C-FMS inhibitor
c-FMS kinase inhibitor research compound
6-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)hexanoic acid
Fmoc-protected amino acid reagent
6-bromo-1H-indazole-4-carboxylic acid
YYONCBWTWPVWRT-UHFFFAOYSA-N
C1=C(C=C2C(=C1C(=O)O)C=NN2)Br
—