4-Chloro-N-methylpicolinamide hydrochloride is a chemical compound that exists as a hydrochloride salt. It is a research reagent primarily used in laboratory settings for the synthesis and study of other chemical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 882167-77-3
4-Chloro-N-methylpicolinamide
Sorafenib intermediate
HIF-2alpha-IN-4
HIF-2a translation inhibitor research compound
25-Hydroxy Cholesterol-d6
Deuterated research standard
Methyl 2-amino-5-bromoisonicotinate
research reagent
2-[2-(2-Azidoethoxy)ethoxy]acetic acid
PEGylation linker for bioconjugation
4-chloro-N-methylpyridine-2-carboxamide;hydrochloride
XGHILPUCRYAWIN-UHFFFAOYSA-N
CNC(=O)C1=NC=CC(=C1)Cl.Cl
—