2-Chloro-3-nitropyrazine is a research compound with a heterocyclic aromatic structure. It is characterized by the presence of a chlorine atom and a nitro group attached to a pyrazine ring, making it a reagent of interest in organic synthesis and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 87885-43-6
Pentafluorophenylmagnesium bromide
Grignard reagent for organic synthesis
(2R,3R,4R,5R,6R)-5-Acetamido-2-(acetoxymethyl)-6-(2-(2-(2-(2-azidoethoxy)ethoxy)ethoxy)ethoxy)tetrahydro-2H-pyran-3,4-diyl diacetate
chemical probe for glycobiology
((2R,3S,4R,5R,6S)-4-(Benzyloxy)-5-(((benzyloxy)carbonyl)amino)-3-hydroxy-6-methoxytetrahydro-2H-pyran-2-yl)methyl benzoate
protected sugar building block
2-(2-chloro-5-nitrophenyl)pyridine
research compound
2-chloro-3-nitropyrazine
WFJAKBGXNXBMLL-UHFFFAOYSA-N
C1=CN=C(C(=N1)[N+](=O)[O-])Cl