This compound is a chiral alcohol used as a research reagent. It features a stereocenter and contains an aromatic ring substituted with chlorine and fluorine atoms, contributing to its specific molecular properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 877397-65-4
Tert-butyl 4-(4-bromo-1H-pyrazol-1-yl)piperidine-1-carboxylate
Research compound for synthesis
Tetrabutylammonium fluoride trihydrate
Phase transfer catalyst and fluorination reagent
H2-Gamendazole
research compound
KG 5
research compound
(alphaR)-2,6-Dichloro-3-fluoro-alpha-methylbenzenemethanol
pharmaceutical intermediate
(1S)-1-(2,6-dichloro-3-fluorophenyl)ethanol
JAOYKRSASYNDGH-BYPYZUCNSA-N
C[C@@H](C1=C(C=CC(=C1Cl)F)Cl)O