4-Bromo-2-nitroaniline is a chemical compound used primarily as a dye intermediate. It features an amine group attached to an aromatic ring with bromine and nitro substituents, making it suitable for synthesizing various dyes and pigments.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 875-51-4
2,4,6-TRIMETHYLANILINE
Dye intermediate
2-Amino-3,5-dimethylbenzenesulfonic acid
Dye intermediate
3-Amino-5-chloro-2-hydroxybenzenesulfonic acid
Dye intermediate for azo dyes
5-Amino-2-chlorobenzenesulfonic Acid
Intermediate for pigment red 58
4-bromo-2-nitroaniline
ZCWBZRBJSPWUPG-UHFFFAOYSA-N
C1=CC(=C(C=C1Br)[N+](=O)[O-])N