This compound is a protected cysteine derivative used as a building block in peptide synthesis. It features a tert-butoxycarbonyl (Boc) protecting group on the amino group and a trityl (Trt) protecting group on the thiol side chain, enabling selective deprotection during solid-phase or solution-phase peptide assembly.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 87494-13-1
2,6-Dichloro-4-methylnicotinonitrile
Pharmaceutical intermediate
D-PHENYLGLYCINE
Pharmaceutical intermediate for peptide synthesis
(3-Formyl-4-(2-iodo-benzyloxy)-phenyl)-acetic acid methyl ester
Pharmaceutical intermediate
Fmoc-L-Ala-L-Ala-OH
Peptide synthesis intermediate
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-tritylsulfanylpropanoic acid
JDTOWOURWBDELG-HSZRJFAPSA-N
CC(C)(C)OC(=O)N[C@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O