m-PEG7-acid is a monodisperse polyethylene glycol (PEG) derivative containing a terminal carboxylic acid group. It is primarily used as a research reagent for PEGylation, a process that modifies biomolecules or surfaces to improve solubility and stability.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 874208-91-0
(2-Cyanopyridin-3-yl)boronic acid
research compound for boronic acid chemistry
3-p-Anisoyl Acacetin
Impurity reference standard for acacetin
(S)-benzyl 2-((S)-2-((S)-2-amino-4-phenylbutanamido)-4-methylpentanamido)-3-phenylpropanoate 2,2,2-trifluoroacetate
research compound
L-Phenylalanine, (alphaS)-alpha-[[2-(4-morpholinyl)acetyl]amino]benzenebutanoyl-L-leucyl-, phenylmethyl ester
research compound
3-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
NOPQIPMESCUIHH-UHFFFAOYSA-N
COCCOCCOCCOCCOCCOCCOCCC(=O)O