2,4-Di-tert-butyl-5-nitrophenol is a substituted phenol compound used as a pharmaceutical intermediate. It features both tert-butyl groups and a nitro group on an aromatic ring, contributing to its structural properties relevant for chemical synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 873055-57-3
16-(2H-tetrazol-5-yl)hexadecanoic acid
pharmaceutical intermediate
2-(2-Aminoanilino)-5-methylthiophene-3-carbonitrile
Pharmaceutical intermediate for API synthesis
(r)-tetrahydrofuran-2-carboxylic acid
pharmaceutical intermediate
(S)-(-)-Tetrahydro-2-furoic acid
Pharmaceutical intermediate for active compounds
2,4-ditert-butyl-5-nitrophenol
VIWYWRSFQRIVPI-UHFFFAOYSA-N
CC(C)(C)C1=CC(=C(C=C1[N+](=O)[O-])O)C(C)(C)C