This compound is a protected polyether intermediate featuring multiple silyl-ether groups and a complex fused-ring system, designed for use in the stereocontrolled synthesis of structurally elaborate polyether natural products. It serves as a building block in pharmaceutical research and development, particularly for constructing molecules with intricate oxygen-containing ring frameworks.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 871360-42-8
1-Cinnamylpiperazine
Pharmaceutical intermediate for flunarizine
3-BROMOTHIOPHENE
Pharmaceutical intermediate for antibiotics and vasodilators
5-Fluoropyridine-3-boronic acid
Pharmaceutical intermediate for synthesis
(R)-2-Aminopent-4-ynoic acid hydrochloride
Pharmaceutical intermediate for amino acid derivatives
(1R,3S,5R,6R,7S,11R,14S,15S,16S,17R,18S,19S,20Z,22R,25S,28S,31S,33R)-5-[(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-16,17,19-tris[[tert-butyl(dimethyl)silyl]oxy]-22-hydroxy-6-methoxy-33-methyl-27,34-dimethylidene-4,35,36,37,38-pentaoxahexacyclo[29.3.1.111,15.114,18.125,28.03,7]octatriacont-20-en-9-one
OPIRHZLSIAZMNY-HEXWNEAUSA-N
C[C@@H]1C[C@@H]2CC[C@H]3C(=C)C[C@@H](O3)CC[C@H](/C=C\[C@@H]([C@H]4[C@H]([C@H]([C@@H]5[C@@H](O4)CC[C@@H](O5)CC(=O)C[C@H]6[C@H](C[C@H](C1=C)O2)O[C@@H]([C@@H]6OC)C[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O