Boc-Val-Cit-OH is a peptide compound featuring a tert-butoxycarbonyl (Boc) protecting group on the N-terminus and a citrulline residue. It is primarily used as a research compound in laboratory settings, particularly for peptide synthesis and biochemical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 870487-08-4
Boc-Val-Cit-PABA
research compound for ADC
5-Chloro-3-iodo-2-methylaniline
research compound
4-(1-Naphthyl)phenylboronic Acid (contains varying amounts of Anhydride)
synthetic building block for cross-coupling
2-AMINO-N,3-DIMETHYLBENZAMIDE
research compound for crystallography
(2S)-5-(carbamoylamino)-2-[[(2S)-3-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoyl]amino]pentanoic acid
ZZLNUAVYYRBTOZ-QWRGUYRKSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)O)NC(=O)OC(C)(C)C