1,5-This compound is a chemical compound used as a research reagent. It is characterized by the presence of ester and halogen functional groups, contributing to its reactivity in organic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 870-78-0
Ethyl 2-bromobutyrate
n.a
1,6-diethyl 2,5-dibromohexanedioate
research compound
2-chloro-3-fluoro-5-hydroxypyridine
research compound
Methyl 3-(5-(2-ethoxy-2-oxoethyl)-2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)propanoate
research compound
4-Cyano-4-(dodecylsulfanylthiocarbonyl)sulfanylpentanoic acid
RAFT polymerization chain transfer agent
2-Cyano-2-propyl dodecyl trithiocarbonate
RAFT polymerization chain transfer agent
diethyl 2,4-dibromopentanedioate
DUSLEJGELFKEAS-UHFFFAOYSA-N
CCOC(=O)C(CC(C(=O)OCC)Br)Br
—