(S)-Pro-xylane is a stereochemically defined compound used as a pharmaceutical intermediate. It features a tetrahydropyran ring with multiple hydroxyl groups, contributing to its polar character.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 868156-46-1
N-Cbz-3-piperidineacetic acid
Pharmaceutical intermediate
4-Methyl-3-(trifluoromethyl)bromobenzene
Pharmaceutical intermediate for synthesis
L-Phenylalanine, (alphaS)-alpha-((2-(4-morpholinyl)acetyl)amino)benzenebutanoyl-L-leucyl-
Carfilzomib intermediate
5-chloro-2-picolinic acid
pharmaceutical intermediate
Hydroxypropyl tetrahydropyrantriol
pharmaceutical raw material
(2S,3R,4S,5R)-2-[(2S)-2-hydroxypropyl]oxane-3,4,5-triol
KOGFZZYPPGQZFZ-BJNUKLAGSA-N
C[C@@H](C[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O