S-Methylisothiourea hemisulfate is a chemical compound consisting of two methyl carbamimidothioate units and one sulfuric acid molecule. It is primarily used as a pharmaceutical intermediate in the synthesis of other compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 867-44-7
2-Methylisothiouronium chloride
research compound
2-benzyl-2,8-diazaspiro[4.5]decane
pharmaceutical intermediate
4-CHLORO-5-METHOXYPYRIDIN-2-AMINE
pharmaceutical intermediate
Ethyl (3S)-4-chloro-3-hydroxybutanoate
pharmaceutical intermediate
(3S,8R,9S,10R,13S,14S)-17,17-diiodo-10,13-dimethyl-2,3,4,7,8,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol
Abiraterone impurity reference standard
methyl carbamimidothioate;sulfuric acid
BZZXQZOBAUXLHZ-UHFFFAOYSA-N
CSC(=N)N.CSC(=N)N.OS(=O)(=O)O