This compound is a pharmaceutical intermediate specifically used in the manufacturing process of Aliskiren, a renin inhibitor. It features a complex structure with multiple ether groups and a chiral center, which is critical for its role in the synthesis of the active pharmaceutical ingredient.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 866030-35-5
Trans-1,4-Dibromo-2-Butene
Aliskiren intermediate
2-(Chloromethyl)-4-methoxy-3-methylpyridine--hydrogen chloride (1/1)
Pharmaceutical intermediate synthesis
2-(Chloromethyl)-4-methoxy-3,5-dimethylpyridine Hydrochloride
Pharmaceutical intermediate
4-nitro-2,3,5-trimethylpyridine, 1-oxide
Pharmaceutical intermediate
Tert-Butyl 4-[6-[[6-(1-Butoxyethenyl)-8-cyclopentyl-5-methyl-7-oxo-7,8-dihydro-pyrido[2,3-d]pyrimidin-2-yl]amino]-pyridin-3-yl]-piperazine-1-carboxylate
pharmaceutical intermediate
(3S,5S)-5-((1S,3S)-1-Amino-3-(4-methoxy-3-(3-methoxypropoxy)benzyl)-4-methylpentyl)-3-isopropyldihydrofuran-2(3H)-one
Active pharmaceutical ingredient intermediate impurity
tert-butyl N-[(1S,3S)-3-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-4-methyl-1-[(2S,4S)-5-oxo-4-propan-2-yloxolan-2-yl]pentyl]carbamate
CYUJPKOZIGBPOO-IGRGDXOOSA-N
CC(C)[C@@H]1C[C@H](OC1=O)[C@H](C[C@H](CC2=CC(=C(C=C2)OC)OCCCOC)C(C)C)NC(=O)OC(C)(C)C