Fmoc-Val-Cit-PAB-PNP is a research reagent used as a peptide conjugation reagent in laboratory settings. It features a complex molecular structure with multiple amide and ether groups, along with aromatic rings, making it suitable for specialized conjugation applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 863971-53-3
(9H-Fluoren-9-yl)methyl ((6S,9S)-1-amino-9-isopropyl-6-((4-((((4-nitrophenoxy)carbonyl)oxy)methyl)phenyl)carbamoyl)-1,8,11,14,17-pentaoxo-2,7,10,13,16-pentaazaoctadecan-18-yl)carbamate
research compound
Boc-Val-Cit-PAB-PNP
Antibody-drug conjugate linker reagent
Bz-Nle-Lys-Arg-Arg-AMC
fluorogenic substrate for proteases
Hexanedioic Acid Mono-(2-carboxyphenyl) Ester
reference standard for impurity analysis
(4-(5-bromo-2-chlorobenzyl)phenoxy)(tert-butyl)dimethylsilane
research compound
3-(9H-Carbazol-9-yl)phenylboronic acid
research compound for organic synthesis
[4-[[(2S)-5-(carbamoylamino)-2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]pentanoyl]amino]phenyl]methyl (4-nitrophenyl) carbonate
USMYACISHVPTHK-PXLJZGITSA-N
CC(C)[C@@H](C(=O)N[C@@H](CCCNC(=O)N)C(=O)NC1=CC=C(C=C1)COC(=O)OC2=CC=C(C=C2)[N+](=O)[O-])NC(=O)OCC3C4=CC=CC=C4C5=CC=CC=C35