This compound is a research compound with an aromatic and polar structure, containing amine, ether, and hydroxyl functional groups. It is supplied as a laboratory reagent for chemical and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 861841-90-9
(S)-(+)-4-Phenyl-2-oxazolidinone
chiral auxiliary for asymmetric synthesis
1-(2,2-Difluoro-1,3-benzodioxol-5-yl)cyclopropanecarboxylic acid
research compound
Cyclo(RGDfC)
research reagent
(3-Morpholinophenyl)boronic acid hydrochloride
research compound
1-(3-amino-2-hydroxy-5-phenylmethoxyphenyl)ethanone
VHNDAASEYRABBJ-UHFFFAOYSA-N
CC(=O)C1=C(C(=CC(=C1)OCC2=CC=CC=C2)N)O