This compound is a research linker reagent featuring a complex polycyclic core with multiple ether and ester functionalities, including a succinate ester group and a trityl-type protecting group. Its significance lies in its use as a building block in chemical synthesis and pharmaceutical research.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 852684-08-3
Phosphonic acid, p-((4-((4-hydroxy-3-(1-methylethyl)phenyl)methyl)-3,5-dimethylphenoxy)methyl)-
certified reference standard impurity
Ru(bpm)3(PF6)2
photoredox catalyst
3',5'-TIPS-N-Ac-Cytidine
protected nucleoside research compound
9-(4-bromophenyl)phenanthrene
research compound
4-[[(3aS,4S,5S,6R,7R,7aR)-6-[bis(4-methoxyphenyl)-phenylmethoxy]-1,3-dioxo-2-phenyl-3a,4,5,6,7,7a-hexahydro-4,7-epoxyisoindol-5-yl]oxy]-4-oxobutanoic acid
KPROLRFVRRGFBD-RHEFJYAGSA-N
COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)O[C@@H]4[C@H]5[C@H]6[C@@H]([C@@H]([C@@H]4OC(=O)CCC(=O)O)O5)C(=O)N(C6=O)C7=CC=CC=C7