This compound is a salt-like organophosphorus compound used as a nucleating agent in plastic materials. It is typically incorporated into polymers at a concentration around 0.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 85209-91-2
ADK Stab NA 21E
plastic additive and stabilizer
4'-(TRANS-4-PROPYLCYCLOHEXYL)-3,4-DIFLUOROBIPHENYL
liquid crystal intermediate
1,2,3,4-Butanetetracarboxylic acid, tetramethyl ester, reaction products with 1,2,2,6,6-pentamethyl-4-piperidinol and .beta.,.beta.,.beta.',.beta.'-tetramethyl-2,4,8,10-tetraoxaspiro[5.5]undecane-3,9-diethanol
plastic additive
Trimethoxy(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane
Coating composition for glass and textiles
1-butoxyethyl methacrylate
methacrylate monomer for polymer synthesis
sodium 1,3,7,9-tetratert-butyl-11-oxido-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide
ZHROMWXOTYBIMF-UHFFFAOYSA-M
CC(C)(C)C1=CC2=C(C(=C1)C(C)(C)C)OP(=O)(OC3=C(C2)C=C(C=C3C(C)(C)C)C(C)(C)C)[O-].[Na+]