Lidocaine D10 is a deuterium-labeled version of lidocaine, where ten hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in mass spectrometry and analytical chemistry for the quantification of lidocaine.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 851528-09-1
5-chloro-2-methoxy-4-methylnicotinic acid
research compound
3-(3-Chloropropyl)-1,3-dihydro-7,8-dimethoxy-2H-3-benzazepin-2-one
research compound
(S)-Ethyl 2-phenyl-2-((S)-piperidin-2-yl)acetate hydrochloride
Research reference standard
2-(3-HYDROXY-1-PHENYLPROPYL)-4-METHYLPHENOL
organic synthesis research chemical
ليدوكائين
local anesthetic and antiarrhythmic agent
Lidocaine hydrochloride monohydrate
active pharmaceutical ingredient
Lidocaine hydrochloride
local anesthetic active pharmaceutical ingredient
N-(2,6-dimethylphenyl)-2-[1,1,2,2,2-pentadeuterioethyl(2,2,2-trideuterioethyl)amino]acetamide
NNJVILVZKWQKPM-IXKWUQSXSA-N
[2H]C([2H])([2H])CN(CC(=O)NC1=C(C=CC=C1C)C)C([2H])([2H])C([2H])([2H])[2H]