This compound is a deuterated form of ethanolamine, specifically labeled with four deuterium atoms at the 1,1,2,2 positions. It is primarily significant as a research reagent for isotopic labeling studies, particularly in mass spectrometry and metabolic tracing experiments.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 85047-08-1
4-(tert-Butoxycarbonyl)phenylboronic acid
research reagent for synthesis
2,5-Difluorophenylacetic acid
Research compound for chemical synthesis
2-Fluoro-4-methylbenzonitrile
research compound
(2R)-2-[[2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S,3R)-2-[[(2S)-2-[[(2S)-2-[[(2S)-4-amino-2-[[(2R)-2-amino-3-sulfanylpropanoyl]amino]-4-oxobutanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxybutanoyl]amino]hexanoyl]amino]propanoyl]amino]acetyl]amino]-3-sulfanylpropanoic acid
research compound
2-Aminoethanol hydrochloride
removal of acid gases
إيثانولامين
metal machining and semiconductor manufacturing additive
2-amino-1,1,2,2-tetradeuterioethanol
HZAXFHJVJLSVMW-LNLMKGTHSA-N
[2H]C([2H])(C([2H])([2H])O)N