1-{[(benzyloxy)carbonyl]amino}cyclopropane-1-carboxylic acid is a chemical compound used as a pharmaceutical intermediate, specifically in peptide synthesis. It features a cyclopropane ring with both carboxylic acid and protected amino functional groups, making it suitable for building specialized peptide structures.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 84677-06-5
1-(((Phenylmethoxy)carbonyl)amino)cyclopentanecarboxylic acid
research compound
5-Methyl-2'-o,4'-C-methylenecytidine
nucleoside analogue intermediate
(S)-tert-Butyl (1-(4-bromophenyl)ethyl)carbamate
Pharmaceutical intermediate for synthesis
1-Methyl-1H-pyrazole-4-boronic acid
Pharmaceutical intermediate for synthesis
1-methyl-5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole
Pharmaceutical intermediate for synthesis
Benzyl (1-(hydroxymethyl)cyclopropyl)carbamate
peptide synthesis protecting reagent
1-(phenylmethoxycarbonylamino)cyclopropane-1-carboxylic acid
KHINKCGJKZSHAJ-UHFFFAOYSA-N
C1CC1(C(=O)O)NC(=O)OCC2=CC=CC=C2