Dipotassium 7-hydroxynaphthalene-1,3-disulphonate is a chemical compound used as a dye intermediate, specifically for naphthol sulfonate dyes. It is a salt form of the corresponding disulfonic acid, featuring two sulfonate groups and a hydroxyl group on a naphthalene ring.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 842-18-2
CIS-PIPERIDINE-2,4-DICARBOXYLIC ACID
pharmaceutical intermediate
AR 260
pharmaceutical intermediate
(2S)-1-(tert-butoxycarbonyl)-4-oxopyrrolidine-2-carboxylic acid
Pharmaceutical intermediate for teneligliptin
1-[(tert-butoxy)carbonyl]piperidine-3-carboxylic acid
Pharmaceutical intermediate
2-Naphthol-6,8-disulfonic acid
Dye intermediate for azo dyes
dipotassium;7-hydroxynaphthalene-1,3-disulfonate
LKDMVWRBMGEEGR-UHFFFAOYSA-L
C1=CC(=CC2=C(C=C(C=C21)S(=O)(=O)[O-])S(=O)(=O)[O-])O.[K+].[K+]