This compound is an Fmoc-protected amino acid derivative featuring a phthalimide-protected lysine side chain. It is primarily used as a building block in solid-phase peptide synthesis, enabling the selective incorporation of modified lysine residues.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 83999-93-3
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(6-methoxypyridin-3-yl)propanoic acid
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3-(4-methoxy-2-methylphenyl)propanoic acid
Fmoc-protected amino acid building block
(S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-2-methyldec-9-enoic acid
Fmoc-protected amino acid building block
3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanoic acid
Fmoc-protected amino acid building block
ثنائي كلورو ثنائي سيانو بنزوكينون
Oxidizing agent in steroid synthesis
N-((9H-Fluoren-9-ylmethoxy)carbonyl)-N-methyl-L-alanine
Peptide synthesis building block
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}(methyl)amino)-3-methylbutanoic acid
amino acid protecting reagent
Chitosan, 2-hydroxypropyl ether
pharmaceutical excipient raw material
(2S)-6-(1,3-dioxoisoindol-2-yl)-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
MDYADJADRHFGPE-VWLOTQADSA-N
C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCCCN4C(=O)C5=CC=CC=C5C4=O)C(=O)O