Hydroxy-alpha-sanshool is a fatty amide found in Sichuan pepper species, such as Zanthoxylum schinifolium, Zanthoxylum bungeanum, and Zanthoxylum piperitum. It is the compound primarily responsible for the characteristic pungent and tingling flavor associated with these peppers.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 83883-10-7
3-Hexanone, 5-mercapto-5-methyl-
Flavor and fragrance ingredient
Methyl 5-allyl-3-methoxysalicylate
flavor and fragrance ingredient
2,4,6-TRICHLOROANISOLE
off-flavor agent in wine corks
BETA-CARYOPHYLLENE
Fragrance and flavoring agent
(2E,6Z,8E,10E)-N-(2-hydroxy-2-methylpropyl)dodeca-2,6,8,10-tetraenamide
LHFKHAVGGJJQFF-UEOYEZOQSA-N
C/C=C/C=C/C=C\CC/C=C/C(=O)NCC(C)(C)O