Lithocholic acid-2,2,4,4-d4 is a deuterated form of lithocholic acid, used as a stable isotope labeled internal standard. It carries four deuterium atoms at specific positions in the steroid backbone, making it valuable for quantitative analysis in research settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 83701-16-0
Glycolithocholic acid-d4
Deuterated bile acid analytical standard
Deoxycholic-2,2,4,4-D4 acid
Deuterated analytical reference standard
Heptanoic-d13 acid
stable isotope labeled internal standard
1,4-Dichlorobenzene-d4
stable isotope labeled internal standard
4-METHYL-D3-CATECHOL
research compound
2-Daos
reagent for cholesterol determination
2-iodo-4,6-diphenyl-1,3,5-triazine
chemical research reagent
4-(4-Methylphenylthio)benzophenone
photoinitiator for polymerization
(4R)-4-[(3R,5R,8R,9S,10S,13R,14S,17R)-2,2,4,4-tetradeuterio-3-hydroxy-10,13-dimethyl-3,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoic acid
SMEROWZSTRWXGI-POXZWENPSA-N
[2H]C1(C[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3CC[C@@H]2C([C@@H]1O)([2H])[2H])CC[C@@H]4[C@H](C)CCC(=O)O)C)C)[2H]