2-Amino-4,5-difluorobenzoic acid is a fluorinated aromatic compound featuring both an amino group and a carboxylic acid group. It is primarily used as a pharmaceutical intermediate in the synthesis of various drug substances.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 83506-93-8
Methyl (3S)-3-aminobutanoate
Pharmaceutical intermediate for beta-amino acid derivatives
2-Hepten-4-yn-1-amine,N,6,6-trimethyl-, (2E)-
pharmaceutical intermediate
2,2-Bis(3-amino-4-hydroxyphenyl)hexafluoropropane
Pharmaceutical intermediate for apixaban synthesis
Minocycline Impurity 40
pharmaceutical intermediate
2-amino-4,5-difluorobenzoic acid
DGOZIZVTANAGCA-UHFFFAOYSA-N
C1=C(C(=CC(=C1F)F)N)C(=O)O