Valiolamine is an unsaturated amino sugar and a C-7 aminocyclitol compound. It is recognized as a potent inhibitor of glycosidase enzymes, making it a valuable research reagent in glycobiology studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 83465-22-9
Indole-3-(4'-oxo)butyric acid
research compound
1,4-Dichlorobutane-d8
deuterated research compound
2-Aminomethyl-18-crown-6
synthetic intermediate for crown ether derivatives
Camphor Impurity 14
certified reference standard impurity
(1S,2S,3R,4S,5S)-5-amino-1-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol
VDLOJRUTNRJDJO-ZYNSJIGGSA-N
C1[C@@H]([C@@H]([C@H]([C@@H]([C@]1(CO)O)O)O)O)N