2,4-Dichloro-3-methylbenzoic acid is an aromatic carboxylic acid containing a benzene ring substituted with chlorine atoms and a methyl group. It is primarily used as a chemical intermediate in industrial and research settings.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 83277-23-0
Dimethyldipropylammonium Hydroxide
structure directing agent
4-Isopropylthioxanthone
Photoinitiator for polymerization
Tris(2-hydroxyethyl) isocyanurate
Plastics heat stabilizer additive
1,3-bis(4-bromophenyl)benzene
industrial chemical intermediate
2,4-dichloro-3-methylbenzoic acid
KYAATGSGTLPBHN-UHFFFAOYSA-N
CC1=C(C=CC(=C1Cl)C(=O)O)Cl