4-Methoxycinnamic acid is a phenolic compound characterized by an aromatic ring, an ether group, and a carboxylic acid group. It is structurally related to hydroxycinnamic acid derivatives and is used primarily in research and chemical supply contexts.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 830-09-1
(E)-3-(4-methoxyphenyl)prop-2-enoic acid
AFDXODALSZRGIH-QPJJXVBHSA-N
COC1=CC=C(C=C1)/C=C/C(=O)O