5-Br-Paps is a sulfonic acid derivative used as a research reagent. Its structure features a brominated pyridyl azo group and a propylaminopropane sulfonic acid moiety, giving it a moderate molecular weight and polar surface area.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 81608-06-2
Tert-Butyl isonicotinate
research compound
2-Bromoethanol-1,1,2,2-d4
deuterated research reagent
Di-T-Butylphosphine
Organophosphine ligand for catalysis
Disodium glycerophosphate
organic sodium salt reagent
3-[4-[(5-bromo-2-pyridinyl)diazenyl]-3-hydroxy-N-propylanilino]propane-1-sulfonic acid
BZRWWAYVITZYRZ-UHFFFAOYSA-N
CCCN(CCCS(=O)(=O)O)C1=CC(=C(C=C1)N=NC2=NC=C(C=C2)Br)O