This compound is a deuterium-labeled derivative of 4-toluenesulfonyl chloride, a sulfonyl chloride reagent. It is used primarily as a synthetic reagent in research settings, where the presence of seven deuterium atoms enables tracing and quantitation in mass spectrometry or nuclear magnetic resonance spectroscopy.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 81255-49-4
(Trifluoromethyl)trimethylsilane
Trifluoromethylation reagent in organic synthesis
(2H2)Malonic (2H2)acid
deuterated malonic acid for research
TRIBUTYLPHOSPHINE OXIDE
research compound
Pp60v-src Autophosphorylation Site, Tyrosine Kinase Substrate
tyrosine kinase substrate research reagent
4-Toluenesulfonyl chloride
Organic synthesis intermediate
2,3,5,6-tetradeuterio-4-(trideuteriomethyl)benzenesulfonyl chloride
YYROPELSRYBVMQ-AAYPNNLASA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])[2H])[2H])[2H])S(=O)(=O)Cl)[2H]