This compound is a deuterated derivative of fluorene in which all ten hydrogen atoms are replaced by deuterium. It is primarily used as an internal standard in mass spectrometry to improve quantification accuracy.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 81103-79-9
Progesterone-2,2,4,6,6,17alpha,21,21,21-d9
deuterated internal standard for mass spectrometry
(R,R)-1,2-Bis[(2-methylphenyl)-(phenyl)phosphino]ethane
chiral ligand for asymmetric synthesis
Methyl N-(diphenylmethylidene)glycinate
research intermediate for amino acid derivatives
811794-35-1
organometallic research reagent
(9H-Fluoren-9-yl)methyl 3-aminopiperidine-1-carboxylate--hydrogen chloride (1/1)
research compound
9H-Fluorene
production of resins and dyes
1,2,3,4,5,6,7,8,9,9-decadeuteriofluorene
NIHNNTQXNPWCJQ-QNNBDYQESA-N
[2H]C1=C(C(=C2C(=C1[2H])C3=C(C(=C(C(=C3C2([2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]