This compound is a protected glycosyl bromide, specifically a per-O-pivaloylated alpha-D-glucopyranosyl bromide. It is primarily used as a building block in the synthesis of oligosaccharides, where the pivaloyl groups serve as protecting groups and the bromide acts as a leaving group for glycosylation reactions.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 81058-27-7
Methyl 4-amino-4-naphthalen-2-yl-butyrate hydrochloride
Pharmaceutical intermediate
3-Aminoethyl-1-N-Cbz-pyrrolidine
Pharmaceutical intermediate
Benzyl 2-(aminomethyl)piperidine-1-carboxylate
Pharmaceutical intermediate for drug synthesis
2,4-Difluorophenylacetic acid
Pharmaceutical intermediate for drug synthesis
[(2R,3R,4S,5R,6R)-6-bromo-3,4,5-tris(2,2-dimethylpropanoyloxy)oxan-2-yl]methyl 2,2-dimethylpropanoate
BSDBCYHGMPHOAL-SFFUCWETSA-N
CC(C)(C)C(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)Br)OC(=O)C(C)(C)C)OC(=O)C(C)(C)C)OC(=O)C(C)(C)C