2-Amino-1-naphthalenesulfonic acid, commonly known as Tobias acid, is an organic compound featuring both an amino group and a sulfonic acid group on a naphthalene ring. It is one of several aminonaphthalenesulfonic acids and is primarily significant as a diazo component in the production of acid dyes and pigments.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 81-16-3
2-aminonaphthalene-1-sulfonic acid
GWIAAIUASRVOIA-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=CC(=C2S(=O)(=O)O)N