Rifaximin is a compound used as an antibiotic active pharmaceutical ingredient. It is characterized by a complex polycyclic structure containing multiple aromatic rings and heterocycles, with a molecular weight of approximately 785 g/mol and a high topological polar surface area.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 80621-81-4
Chlorhydroxyquinoline
antibacterial and antifungal agent
Colistin methane sulfonate
active pharmaceutical ingredient
Semax
active pharmaceutical ingredient
Sancycline
antibiotic active pharmaceutical ingredient
Rifaximin-d6 (Major)
deuterated active pharmaceutical ingredient
[(7S,9E,11S,12R,13S,14R,15R,16R,17S,18S,19E,21Z)-2,15,17,36-tetrahydroxy-11-methoxy-3,7,12,14,16,18,22,30-octamethyl-6,23-dioxo-8,37-dioxa-24,27,33-triazahexacyclo[23.10.1.14,7.05,35.026,34.027,32]heptatriaconta-1(35),2,4,9,19,21,25(36),26(34),28,30,32-undecaen-13-yl] acetate
NZCRJKRKKOLAOJ-XRCRFVBUSA-N
C[C@H]1/C=C/C=C(\C(=O)NC2=C(C3=C(C4=C(C(=C3O)C)O[C@@](C4=O)(O/C=C/[C@@H]([C@H]([C@H]([C@@H]([C@@H]([C@@H]([C@H]1O)C)O)C)OC(=O)C)C)OC)C)C5=C2N6C=CC(=CC6=N5)C)O)/C