This compound is a beta-lactam-structured pharmaceutical intermediate specifically used in the manufacture of cephalosporin antibiotics. It features multiple ring systems and polar functional groups consistent with its role in antibiotic synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 80370-59-8
(6R,7R)-7-Amino-3-(methoxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
cephalosporin antibiotic intermediate
(1R)-1-(4-Bromophenyl)-2,2,2-trifluoroethan-1-ol
Pharmaceutical intermediate
(6alpha,11beta,16alpha,17alpha)-6,9-difluoro-11-hydroxy-16-methyl-3-oxo-17-(1-oxopropoxy)androsta-1,4-diene-17-carbothioic acid
Pharmaceutical intermediate for fluticasone propionate
Acetazolamide Impurity F
pharmaceutical impurity standard
2-aminocyclopentane-1-carbonitrile
pharmaceutical intermediate
(6R,7R)-7-amino-3-(furan-2-carbonylsulfanylmethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
ZMPDMYFTSINIIZ-LDYMZIIASA-N
C1C(=C(N2[C@H](S1)[C@@H](C2=O)N)C(=O)O)CSC(=O)C3=CC=CO3