Lilial is a synthetic aromatic compound with a strong floral odor, primarily used as a fragrance ingredient in cosmetics and consumer products. It has been reported in certain plant species such as Pinellia ternata and Solanum lycopersicum.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 80-54-6
3-(4-tert-butylphenyl)-2-methylpropanal
SDQFDHOLCGWZPU-UHFFFAOYSA-N
CC(CC1=CC=C(C=C1)C(C)(C)C)C=O