α-Methylserotonin (αMS) is a tryptamine derivative closely related to the neurotransmitter serotonin. It acts as a non-selective serotonin receptor agonist and is used in scientific research to study the serotonin system.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 79069-13-9
(R)-tert-Butyl (4-hydroxybutan-2-yl)carbamate
pharmaceutical intermediate
Tert-Butyl 4-Oxopiperidine-1-carboxylate
Pharmaceutical intermediate for synthesis
(S)-1-Nitrosopyrrolidine-2-carboxamide
nitrosamine impurity standard
2-chloroquinoline-6-carbaldehyde
Pharmaceutical intermediate
(1R,4S)-2-Azabicyclo[2.2.1]hept-5-en-3-one
synthetic precursor for drugs
tert-butyl N-[(2S)-1-hydroxypropan-2-yl]carbamate
PDAFIZPRSXHMCO-LURJTMIESA-N
C[C@@H](CO)NC(=O)OC(C)(C)C