Tetrachlorobisphenol A is a chlorinated derivative of bisphenol A used primarily as a flame retardant monomer in the production of epoxy, polyester, and polycarbonate resins. Its structure contains four chlorine atoms and two hydroxyl groups, contributing to its flame-retardant properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 79-95-8
3,3'-Dimethylbisphenol A
Manufacture of plastics and resins
Bis(4-chlorobenzoic) anhydride
Chemical intermediate for organic synthesis
Sodium permanganate monohydrate
Oxidizing agent, chemical raw material
TRIPHENYLPHOSPHINE OXIDE
organophosphorus compound and reaction byproduct
2,6-dichloro-4-[2-(3,5-dichloro-4-hydroxyphenyl)propan-2-yl]phenol
KYPYTERUKNKOLP-UHFFFAOYSA-N
CC(C)(C1=CC(=C(C(=C1)Cl)O)Cl)C2=CC(=C(C(=C2)Cl)O)Cl