2-Naphthol-d8 is a deuterated research reagent used as a reference standard in analytical chemistry. Its isotopic labeling with deuterium allows for precise quantification and tracing in mass spectrometry and NMR spectroscopy.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 78832-61-8
(3-acetamidophenyl)boronic acid
research compound for organic synthesis
2-NITROPYRENE
research compound
Oxalyl chloride
chlorinating reagent in organic synthesis
Benzenesulfonamide, 5-amino-2-methyl-N-phenyl-
sulfonamide research compound
2-NAPHTHOL
dye and pigment intermediate
2-Naphthol-1,3,4,5,6,7,8-d7
Deuterated research reference standard
1,2,3,4,5,6,8-heptadeuterio-7-deuteriooxynaphthalene
JWAZRIHNYRIHIV-GZORGGLCSA-N
[2H]C1=C(C(=C2C(=C(C(=C(C2=C1[2H])[2H])[2H])O[2H])[2H])[2H])[2H]