Diethyl (3-fluoro-4-nitrophenyl)methylmalonate is a chemical compound bearing a methylmalonate diester framework substituted with a fluorinated nitroaryl group. It is primarily used as a synthetic intermediate in the preparation of various pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 78543-06-3
Diethyl (4-amino-3-fluorophenyl)methylmalonate
pharmaceutical intermediate
3-(TRIFLUOROMETHYL)BENZENEPROPANOL
Pharmaceutical intermediate
(S)-(-)-2-Amino-3-methyl-1,1-diphenyl-1-butanol
Chiral pharmaceutical intermediate
2-chloro-3-iodopyridine
pharmaceutical intermediate
diethyl 2-(3-fluoro-4-nitrophenyl)-2-methylpropanedioate
VHMVOAWAZZEEPH-UHFFFAOYSA-N
CCOC(=O)C(C)(C1=CC(=C(C=C1)[N+](=O)[O-])F)C(=O)OCC