2-(4-Fluorophenyl)indole is a chemical compound used primarily as a research reagent. It features an indole core substituted with a fluorophenyl group, contributing to its aromatic and halogen-containing structure.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 782-17-2
Clomipramine Impurity 11
nitrosamine impurity reference standard
3-bromo-4-fluorobenzyl bromide
organic synthesis building block
4-(Trifluoromethoxy)cinnamic acid
Research compound
D-erythro-Ritalinic Acid
research compound
DAPI dihydrochloride
fluorescent DNA staining reagent
2-(4-fluorophenyl)-1H-indole
VLHGDCJIDNVRFM-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C(N2)C3=CC=C(C=C3)F