Ammonium chromate is an industrial chemical used primarily in photography and textile printing. It serves as a sensitizer for gelatin coatings in photography and as a mordant in dyeing processes.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 7788-98-9
ثنائي كرومات الأمونيوم
Petroleum production and refining
ميتافانادات الأمونيوم
vanadium purification intermediate and catalyst precursor
بيرينات الأمونيوم
commercial form of rhenium
نترات الأمونيوم
Fertilizer and explosive manufacturing
POTASSIUM CHROMATE
Oxidizing agent in analytical chemistry
Chromium(III) nitrate nonahydrate
Catalyst, textile printing, corrosion inhibitor
CESIUM NITRATE
used to make other cesium salts
Fluorosulfonic acid
Fluorinating agent and catalyst
diazanium;dioxido(dioxo)chromium
MFFLHUNPSHBKRG-UHFFFAOYSA-P
[NH4+].[NH4+].[O-][Cr](=O)(=O)[O-]